# inspector

**Inspector Module**

**What is the Inspector Module?**

It's a tool that allows you to debug and inspect your Node.js code while it's running. With the inspector module, you can:

* **Set breakpoints:** Stop the code at specific lines to examine the state of your program.
* **Evaluate expressions:** Execute JavaScript code and see the results in real-time.
* **Inspect objects and variables:** View the values and properties of objects and variables in your code.
* **Profile code:** Measure the performance of your code and identify bottlenecks.

**How to Use the Inspector Module**

To use the inspector module, you need to start the Node.js process with the `--inspect` flag. This will enable the inspector and make it listen for connections on a specific port (usually 9229).

Once the inspector is running, you can connect to it using a variety of tools:

* **Chrome DevTools:** Open Chrome DevTools (available in Chrome or as a standalone app) and navigate to the "Sources" tab.
* **Node.js Debugger:** Run `node debug <script.js>` to open a debugging session in the Node.js REPL.
* **Third-party tools:** There are many other tools available that can connect to the inspector, such as VSCode, WebStorm, and Debugger.js.

**Real-World Applications**

The inspector module is essential for debugging complex Node.js applications. Here are some examples of how it can be used:

* **Identify bugs:** Set breakpoints at critical points in your code to see what's going wrong.
* **Optimize code:** Profile your code to find slow parts and improve performance.
* **Learn about new APIs:** Inspect objects and variables to see how they work and how to use them in your code.

**Code Example**

To start the inspector, use the `--inspect` flag:

```
node --inspect script.js
```

Then, open Chrome DevTools (or another debugging tool) and navigate to the "Sources" tab. You should see your script loaded in the inspector.

To set a breakpoint, click on the line number of the code you want to break at. The breakpoint will be marked with a red dot.

To evaluate an expression, open the "Console" tab in Chrome DevTools and type in the expression you want to run. Press Enter to execute the expression.

**Potential Applications**

* **Web development:** Debugging Node.js applications that run on the server-side of web applications.
* **Mobile development:** Debugging Node.js applications that run on mobile devices (using React Native, for example).
* **Desktop development:** Debugging Node.js applications that run on desktop computers (using Electron, for example).
* **Cloud development:** Debugging Node.js applications that run on cloud platforms (AWS, GCP, Azure).

***

**Promises API**

Promises are a way to handle asynchronous operations in JavaScript. They represent the eventual result of an operation, and can be used to chain together multiple operations.

**Creating a Promise**

```javascript
const myPromise = new Promise((resolve, reject) => {
  // Do something asynchronous
  if (success) {
    resolve("Success");
  } else {
    reject("Error");
  }
});
```

* The `Promise` constructor takes a function as its argument.
* The function has two parameters:
  * `resolve`: A function to call when the operation succeeds. The argument to `resolve` will be the result of the operation.
  * `reject`: A function to call when the operation fails. The argument to `reject` will be the error message.

**Consuming a Promise**

```javascript
myPromise.then(
  (result) => {
    // Handle the successful result
  },
  (error) => {
    // Handle the error
  }
);
```

* The `then` method takes two functions as its arguments.
* The first function is called when the promise resolves successfully.
* The second function is called when the promise is rejected.

**Chaining Promises**

```javascript
const myPromise = new Promise((resolve, reject) => {
  // Do something asynchronous
  if (success) {
    resolve("Success");
  } else {
    reject("Error");
  }
});

myPromise
  .then((result) => {
    // Do something with the result
    return anotherPromise;
  })
  .then((result) => {
    // Do something with the result of the second promise
  });
```

* Promises can be chained together using the `then` method.
* The result of each promise can be passed to the next promise in the chain.

**Real-World Applications**

* **HTTP requests:** Promises can be used to handle asynchronous HTTP requests.
* **File I/O:** Promises can be used to handle asynchronous file I/O.
* **Database queries:** Promises can be used to handle asynchronous database queries.

**Benefits of Promises**

* Promises make it easier to handle asynchronous operations.
* Promises can be chained together to create complex workflows.
* Promises provide a consistent way to handle errors.

***

#### Class: `inspector.Session`

* Extends: {EventEmitter}

The `inspector.Session` class is used for managing sessions with the V8 inspector back-end. It provides methods for sending messages to the inspector back-end, receiving responses and notifications, and managing breakpoints.

#### Main concepts

* **Session**: A session represents a connection to the V8 inspector back-end. Sessions can be created using the `inspector.connect` method.
* **Messages**: Messages are used to communicate with the inspector back-end. Messages can be sent using the `session.post` method.
* **Responses**: Responses are sent by the inspector back-end in response to messages. Responses can be received using the `session.on('message')` event listener.
* **Notifications**: Notifications are sent by the inspector back-end to provide updates on the state of the inspected application. Notifications can be received using the `session.on('notification')` event listener.
* **Breakpoints**: Breakpoints can be set in the inspected application using the `session.setBreakpoint` method. Breakpoints can be used to pause the application at specific points in the code.

#### Real-world applications:

* **Debugging**: Sessions can be used to debug applications running in Node.js. By sending messages to the inspector back-end, developers can retrieve information about the application's state, set breakpoints, and step through the code.
* **Profiling**: Sessions can be used to profile applications running in Node.js. By sending messages to the inspector back-end, developers can retrieve information about the application's performance, including CPU usage, memory usage, and event loop latency.
* **Testing**: Sessions can be used to test applications running in Node.js. By sending messages to the inspector back-end, developers can retrieve information about the application's state, set breakpoints, and step through the code.

#### Usage example:

```
const inspector = require('inspector');

// Create a session with the inspector back-end
const session = new inspector.Session();

// Send a message to the inspector back-end
session.post('Runtime.evaluate', { expression: '1 + 1' }, (err, response) => {
  if (err) {
    console.error(err);
  } else {
    console.log(response.result.value); // 2
  }
});

// Receive a notification from the inspector back-end
session.on('notification', (notification) => {
  console.log(notification.method); // 'Debugger.paused'
  console.log(notification.params.reason); // 'breakpoint'
});
```

***

**Simplified Explanation:**

`inspector.Session()` is a class in Node.js that allows you to create a new "session" with the Chrome Developer Tools (DevTools) Inspector. This session lets you control and inspect your running Chrome browser from your Node.js application.

**Topics:**

**1. Creating a Session:**

* Call `new inspector.Session()` to create a new session object.
* You need to "connect" this session to the browser before using it. See `session.connect()`.

**2. Connecting a Session:**

* After creating a session, you need to connect it to the browser.
* You can do this using `session.connect()` and provide the port or URL where the browser's DevTools is running.

**3. Dispensing Messages:**

* Once the session is connected, you can send commands to the browser and receive responses.
* These commands are sent as messages and are processed by the browser's DevTools backend.

**4. Console Output Handling:**

* When using `Session`, the output displayed in the browser's console is not automatically cleared.
* To clear it, you need to send a `Runtime.DiscardConsoleEntries` command manually.

**5. Potential Applications:**

* Debugging and inspecting running Chrome browsers remotely.
* Automating browser testing and analysis.
* Analyzing and modifying browser behavior.

**Example Code:**

```javascript
const { inspector } = require("inspector");

// Create a session object
const session = new inspector.Session();

// Connect to the browser
session.connect({ host: "localhost", port: 9222 });

// Send a command to the browser
session.post("Runtime.evaluate", {
  expression: 'console.log("Hello, world!")',
});

// Wait for the response from the browser
session.on("message", (message) => {
  if (message.method === "Runtime.evaluate") {
    console.log("Response received:", message.params.result.value);
  }
});
```

**Real-World Application:**

* A testing framework could use `inspector.Session()` to automate browser testing by sending commands to the browser, capturing console output, and verifying the results.
* A debugging tool could use it to remotely connect to and inspect a running browser, helping developers identify and fix issues.

***

**Event: `'inspectorNotification'`**

* {Object} The notification message object

**Description:**

This event is emitted when you receive a notification from the V8 Inspector. The V8 Inspector is a tool that lets you debug and inspect your JavaScript code.

**Example:**

The following code logs the method of the notification message object:

```js
session.on("inspectorNotification", (message) => console.log(message.method));
```

**Output:**

```
Debugger.paused
Debugger.resumed
```

**Real-World Applications:**

This event can be used to debug and inspect your JavaScript code. For example, you could use it to log the state of your application at different points in time, or to track down bugs.

**Additional Notes:**

It is also possible to subscribe only to notifications with a specific method. For example, the following code subscribes only to notifications with the `Debugger.paused` method:

```js
session.on("inspectorNotification", (message) => {
  if (message.method === "Debugger.paused") {
    // Do something
  }
});
```

***

**Simplified Explanation:**

The `inspector-protocol-method` event is emitted when a specific notification (also known as an event) is received from the inspector protocol in the Chrome DevTools.

**How it Works:**

When you use the Chrome DevTools to debug or inspect a Node.js program, the DevTools communicates with the Node.js process through the inspector protocol. The inspector protocol allows the DevTools to send commands and receive notifications from the Node.js process about various events, such as breakpoints, errors, and more.

**Real-World Example:**

You can use the `inspector-protocol-method` event to handle and process specific inspector notifications in your Node.js application. For example, you can use it to:

**1. Listen for Breakpoint Notifications:**

You can listen for the `'Debugger.paused'` notification to know when the program execution has stopped due to a breakpoint. Here's an example:

```javascript
// Listen for the 'Debugger.paused' notification.
session.on("Debugger.paused", ({ params }) => {
  // Print the reason for suspension (e.g., breakpoint hit).
  console.log(params.reason); // Example: "breakpoint"
});
```

**2. Monitor Console Events:**

You can listen for the `'Runtime.consoleAPICalled'` notification to capture console events (like `console.log()`) in your application. Here's an example:

```javascript
// Listen for the 'Runtime.consoleAPICalled' notification.
session.on("Runtime.consoleAPICalled", ({ params }) => {
  // Print the console output and its type.
  const { type, args } = params;
  console.log(`Console Output: ${args[0]} (${type})`);
});
```

**Potential Applications:**

* **Debugging and Troubleshooting:** Handle specific notifications to enhance debugging capabilities and provide more context for errors.
* **Monitoring and Analysis:** Capture and analyze specific events in your application for performance monitoring or behavior analysis.
* **Custom Reporting and Visualization:** Integrate the handling of notifications for creating custom reports or visualizations based on the received event data.

**Note:**

* The `inspector-protocol-method` event can receive any type of notification defined in the inspector protocol.
* You can use the [Chrome DevTools documentation](https://chromedevtools.github.io/devtools-protocol/) to find the list of all supported notifications and their respective parameters.

***

### `session.connect()`

#### What is `session.connect()`?

`session.connect()` is a method in the `inspector` module that allows you to establish a connection between your Node.js process and the inspector back-end.

#### How does it work?

The inspector back-end is a component that runs inside the Node.js process and allows you to inspect and debug your code. By connecting to the inspector back-end, you can use tools like the Chrome DevTools to view the state of your application, set breakpoints, and step through code.

#### Why would you use it?

You would use `session.connect()` if you want to use the Chrome DevTools to debug your Node.js application.

#### How do you use it?

To use `session.connect()`, you first need to start the inspector back-end in your Node.js process. You can do this by passing the `--inspect` flag to the Node.js executable, like this:

```
node --inspect index.js
```

Once the inspector back-end is running, you can use the `session.connect()` method to establish a connection between your Node.js process and the inspector back-end. The `session.connect()` method takes a callback function as its only argument. The callback function is called when the connection is established, and it is passed an object representing the inspector session.

Here is an example of how to use the `session.connect()` method:

```
const inspector = require('inspector');

inspector.session.connect((err, session) => {
  if (err) {
    console.error('Could not connect to inspector back-end:', err);
    return;
  }

  // The session object represents the inspector session. You can use it to
  // inspect and debug your code.
  // ...
});
```

#### Potential applications

Some potential applications of `session.connect()` include:

* Debugging Node.js applications
* Profiling Node.js applications
* Setting breakpoints in Node.js code
* Stepping through Node.js code
* Viewing the state of Node.js objects

***

**Simplified Explanation:**

**session.connectToMainThread()** allows you to connect a debugging session to the main thread of your program. This is useful when you want to debug the main thread of your application, which is usually responsible for handling the user interface and main functionality.

**Detailed Explanation:**

**Worker Thread:**

Node.js supports the use of worker threads, which are separate threads that run independently of the main thread. This allows you to perform certain tasks, such as heavy computations, without affecting the responsiveness of the main thread.

**Inspector Back-End:**

The inspector back-end is a component of the Node.js process that allows you to connect a debugger to your application. It provides access to information about the running program, such as the code, variables, and call stack.

**Connecting to Main Thread:**

The `session.connectToMainThread()` function allows you to connect a debugging session to the main thread inspector back-end. This is necessary if you want to debug the main thread, as it is not automatically connected by default.

**Exception Handling:**

As mentioned in the documentation, an exception will be thrown if you try to call this function from the main thread. This is because the main thread is already connected to the inspector back-end.

**Real-World Example:**

Suppose you have a web application that runs on Node.js and you want to debug an issue with the user interface. You would need to connect a debugging session to the main thread to inspect the code and variables that are responsible for handling the UI. This can help you identify and fix any problems without affecting the rest of the application.

**Potential Applications:**

* Debugging complex user interfaces
* Troubleshooting performance issues on the main thread
* Identifying and fixing memory leaks or other resource leaks
* Understanding the flow of execution and interactions on the main thread

***

**Topic: Closing a Session**

**Simplified Explanation:**

Imagine you're chatting with a friend online. When you close the chat window, the connection between you and your friend is ended, and you can't continue the conversation until you reconnect.

In the same way, when you call `session.disconnect()`, you're effectively closing the connection between your code and the inspector. This means that any messages you've sent that haven't been processed yet will now return an error, and you won't be able to send new messages until you reconnect.

**Code Snippet:**

```javascript
const { Session } = require("inspector");

// Create a session
const session = new Session();

// Connect to the inspector
session.connect();

// Close the session immediately
session.disconnect();

// Attempt to send a message after closing the session
session.post("Runtime.evaluate", { expression: "1 + 1" }, (err, result) => {
  // This callback will receive an error because the session is closed
  console.log(err);
});
```

**Real World Application:**

Disconnecting a session can be useful in situations where you want to reset the state of the inspector or close a connection that is no longer needed. For example, you might want to disconnect a session if you're switching between debugging different processes or if you've encountered an error that you can't resolve.

***

**Simplified Explanation of `session.post()` Method**

**What is `session.post()`?**

`session.post()` is a method used to send messages to the inspector back-end, which is a tool for debugging and monitoring your code. It allows you to control the inspector and get information about the running program.

**Parameters:**

* `method`: The type of message you want to send. This corresponds to a specific command supported by the inspector.
* `params` (optional): Any additional parameters that the command requires.

**How to Use `session.post()`:**

1. **Import the Inspector Module:**

   ```javascript
   import { Session } from "node:inspector/promises";
   ```
2. **Create a Session:**

   ```javascript
   const session = new Session();
   ```
3. **Connect to the Inspector Back-End:**

   ```javascript
   session.connect();
   ```
4. **Send a Message:**

   ```javascript
   const result = await session.post(methodName, params);
   ```

   Where `methodName` is the command you want to execute, and `params` are any necessary parameters.

**Example:**

```javascript
import { Session } from "node:inspector/promises";

try {
  const session = new Session();
  session.connect();
  const result = await session.post("Runtime.evaluate", {
    expression: "2 + 2",
  });
  console.log(result);
} catch (error) {
  console.error(error);
}
```

In this example, we send a message to the inspector back-end to evaluate the expression `2 + 2`. The result is a Promise that resolves to an object containing the result of the evaluation.

**Real-World Applications:**

* **Debugging:** Inspecting the state of your running program and identifying any issues.
* **Profiling:** Measuring the performance of your code and optimizing it for efficiency.
* **Monitoring:** Keeping track of events and changes within your program during execution.

***

#### V8 Profilers

V8 Profilers are tools that help you understand how your JavaScript code is running. They can help you find performance bottlenecks and improve the efficiency of your code.

There are two main types of V8 Profilers:

* **CPU Profilers** measure how much time your code is spending in different functions.
* **Memory Profilers** measure how much memory your code is using.

#### Using V8 Profilers

You can use V8 Profilers through the DevTools protocol. To do this, you need to open the DevTools in your browser and select the "Profiles" tab.

Once you have opened the "Profiles" tab, you will see a list of available V8 Profilers. You can select the profiler you want to use by clicking on it.

#### Real-World Applications of V8 Profilers

V8 Profilers can be used to improve the performance of your JavaScript code in a variety of ways. Here are a few examples:

* You can use a CPU Profiler to find performance bottlenecks in your code. Once you have identified the bottlenecks, you can then optimize your code to improve performance.
* You can use a Memory Profiler to identify memory leaks in your code. Memory leaks can cause your application to slow down or even crash. By identifying memory leaks, you can fix them and improve the stability of your application.

#### Conclusion

V8 Profilers are powerful tools that can help you improve the performance and stability of your JavaScript code. By using these tools, you can identify performance bottlenecks, memory leaks, and other issues that can affect the performance of your application.

***

### CPU Profiler

The CPU Profiler helps you identify performance bottlenecks in your Node.js application by measuring CPU usage.

#### How to use the CPU Profiler

1. **Start the CPU Profiler:**

   ```javascript
   const session = new Session(); // Create a new inspector session
   await session.connect(); // Connect to the inspector endpoint

   await session.post("Profiler.enable"); // Enable the Profiler
   await session.post("Profiler.start"); // Start profiling
   ```
2. **Execute your code under measurement:**

   ```javascript
   // Execute the code you want to profile here
   ```
3. **Stop the CPU Profiler:**

   ```javascript
   const { profile } = await session.post("Profiler.stop"); // Stop profiling and retrieve the profile data
   ```
4. **Analyze the profile data:**

   ```javascript
   // Write the profile data to a file or upload it to a service for analysis
   fs.writeFileSync("./profile.cpuprofile", JSON.stringify(profile));
   ```

#### Real-world applications

The CPU Profiler can be used to:

* Identify bottlenecks in your code that are consuming excessive CPU resources
* Optimize your code to improve performance
* Debug performance issues in production environments

#### Example code

```javascript
// Demo script that generates a CPU profile for a Fibonacci function
const session = new Session(); // Create a new inspector session
await session.connect(); // Connect to the inspector endpoint

await session.post("Profiler.enable"); // Enable the Profiler
await session.post("Profiler.start"); // Start profiling

// Execute the Fibonacci function under measurement
function fibonacci(n) {
  if (n <= 1) {
    return n;
  }

  return fibonacci(n - 1) + fibonacci(n - 2);
}

console.log(fibonacci(40)); // Calculate the 40th Fibonacci number

// Stop profiling and retrieve the profile data
const { profile } = await session.post("Profiler.stop");

// Write the profile data to a file
fs.writeFileSync("./profile.cpuprofile", JSON.stringify(profile));
```

***

#### Heap Profiler

**What is a Heap Profiler?**

A heap profiler helps you investigate memory usage in your Node.js application. It shows you which objects are taking up the most memory and how they are connected to each other.

**How to Use the Heap Profiler**

To use the heap profiler, you need to connect to your Node.js application with the `inspector` module.

```javascript
const { Session } = require("inspector/promises");

const session = new Session();

session.connect();
```

Once connected, you can start taking heap snapshots:

```javascript
const result = await session.post("HeapProfiler.takeHeapSnapshot", null);
console.log("HeapProfiler.takeHeapSnapshot done:", result);
```

The heap snapshot will be saved to a file on your disk. You can then use a tool like Chrome DevTools or Node.js tools like `pprof` to analyze the snapshot.

#### Real World Applications

Heap profilers can be used to:

* Identify memory leaks
* Optimize memory usage
* Understand the performance characteristics of your application

**Potential Applications in Real World**

* **Memory Leak Detection:** Identifying memory leaks is one of the most common uses of heap profilers. A memory leak occurs when an object is no longer referenced by your code but is still taking up memory. Heap profilers can help you identify these objects and their references.
* **Performance Optimization:** Heap profilers can also be used to identify performance bottlenecks. The heap snapshot can show you which objects are taking the most time to allocate and release. You can then use this information to optimize your code.
* **Code Understanding:** Heap profilers can be used to gain a better understanding of your code. The heap snapshot can show you how objects are connected to each other and how they are used. This information can be helpful for debugging and understanding the overall structure of your application.

***

### Callback API

**What is a Callback API?**

Imagine you hire a plumber to fix a leak. You give them instructions and ask them to come back and tell you when it's fixed. This is a callback. The plumber is the callback function, and you're the code that calls the callback function.

In Node.js, the callback API is a way for asynchronous functions (functions that don't complete immediately) to notify your code when they're done.

**How does it work?**

You call an asynchronous function and pass it a callback function as an argument. When the asynchronous function completes, it calls your callback function with the result.

```javascript
fs.readFile("myfile.txt", function (err, data) {
  if (err) throw err;
  console.log(data);
});
```

In this example, `fs.readFile()` is an asynchronous function that reads a file. We pass it a callback function that prints the file's contents to the console. When `fs.readFile()` is finished, it calls our callback function with the result (the file's contents).

**Benefits of Callback API**

* **Asynchronous:** Allows your code to continue running while asynchronous functions are executing.
* **Easy to use:** Simple syntax and easy to understand.
* **Widely supported:** Used in many Node.js modules and libraries.

**Potential Applications**

* **Server-side programming:** Handling HTTP requests and responses asynchronously.
* **File I/O:** Reading and writing files asynchronously.
* **Database operations:** Performing database queries asynchronously.

***

**Class: Session**

**Simplified Explanation:**

Imagine the `inspector.Session` as a special messenger between your program and a hidden part of V8, called the V8 inspector. This messenger lets you send messages to the inspector and receive responses and notifications back.

**Topics in Detail:**

* **Sending Messages:**
  * Your program can send messages to the V8 inspector using the `post` method. These messages contain commands or requests for information.
* **Receiving Responses:**
  * When the V8 inspector responds to a message, the `inspector.Session` will emit a `'message'` event with the response.
* **Receiving Notifications:**
  * The `inspector.Session` also emits events for notifications, such as when a new breakpoint is hit or an exception occurs.

**Real-World Applications:**

* **Debugging:** The V8 inspector allows you to debug your JavaScript code interactively. The `inspector.Session` is used to send and receive messages for setting breakpoints, inspecting variables, and stepping through code.
* **Profiling:** The V8 inspector can profile your JavaScript code to identify performance bottlenecks. The `inspector.Session` is used to start and stop profiling, and to retrieve profiling data.
* **Testing:** The V8 inspector can be used to write automated tests for your JavaScript code. The `inspector.Session` is used to send commands to the inspector to perform actions and verify results.

**Complete Code Implementation:**

```javascript
const { inspector } = require("inspector");

// Create a new `inspector.Session` to communicate with the inspector.
const session = new inspector.Session();

// Connect to the inspector.
session.connect();

// Send a message to set a breakpoint.
session.post("Debugger.setBreakpointByUrl", {
  lineNumber: 10,
  url: "file:///path/to/script.js",
});

// Listen for the response from the inspector.
session.on("message", (message) => {
  // The message contains the result of the breakpoint command.
});

// Close the `inspector.Session`.
session.disconnect();
```

***

### Creating an Inspector Session

The `inspector.Session()` class in Node.js allows you to create a new session with an inspector backend. Here's a simplified explanation:

**What is an Inspector Session?**

An inspector session is a connection to a browser's developer tools, which allows you to inspect and debug your web application. You can use it to view the console, set breakpoints, and modify JavaScript code on the fly.

**Creating a Session:**

To create a new inspector session, you use the `new inspector.Session()` constructor. This will create an instance of the `Session` class that represents the connection to the inspector backend.

```typescript
const { Session } = require("inspector");

const session = new Session();
```

**Connecting to the Backend:**

Before you can use the inspector session, you need to connect to the inspector backend. This is typically done using the \[`connect()`]\[] method.

```typescript
await session.connect();
```

**Using the Session:**

Once connected, you can use the inspector session to send commands and receive events from the inspector backend. For example, to send a `Runtime.evaluate` command, you would use the \[`post()`]\[] method.

```typescript
const result = await session.post("Runtime.evaluate", {
  expression: "1 + 2",
});
```

This will return the result of evaluating the expression `1 + 2` on the inspector backend.

**Real-World Applications:**

* Debugging web applications in real-time
* Inspecting the state of the browser DOM and JavaScript objects
* Modifying JavaScript code while the application is still running

**Example:**

Here's a simplified example of using the inspector session to evaluate a JavaScript expression and print the result to the console:

```typescript
const { Session } = require("inspector");

const session = new Session();

session.connect().then(() => {
  session
    .post("Runtime.evaluate", {
      expression: "1 + 2",
    })
    .then((result) => {
      console.log(result.result.value); // Prints 3
      session.disconnect();
    });
});
```

***

**What is the `'inspectorNotification'` Event?**

The `'inspectorNotification'` event is emitted by the `inspector` module in Node.js when a notification is received from the V8 Inspector. The V8 Inspector is a tool that allows you to debug and inspect your Node.js code.

**How to Use the `'inspectorNotification'` Event**

To use the `'inspectorNotification'` event, you can add a listener to it using the `on()` method. The listener function will be called whenever a notification is received from the V8 Inspector.

```js
const { session } = require("inspector");

// Create an Inspector session.
const session = new session();

// Add a listener to the 'inspectorNotification' event.
session.on("inspectorNotification", (message) => {
  console.log(message.method);
});
```

**What is a Notification?**

A notification is a message that is sent from the V8 Inspector to the Node.js process. Notifications can contain information about various events, such as:

* When a breakpoint is hit
* When a function is called
* When an object is created or destroyed

**Real-World Applications**

The `'inspectorNotification'` event can be used for a variety of purposes, including:

* Debugging your code
* Profiling your code
* Testing your code

**Example**

Here is an example of how you can use the `'inspectorNotification'` event to debug your code:

```js
const { session } = require("inspector");

// Create an Inspector session.
const session = new session();

// Add a listener to the 'inspectorNotification' event.
session.on("inspectorNotification", (message) => {
  if (message.method === "Debugger.paused") {
    // A breakpoint has been hit.
    console.log(
      `Breakpoint hit at line ${message.params.callFrames[0].location.lineNumber}`
    );
  }
});

// Set a breakpoint on a specific line of code.
session.post("Debugger.setBreakpoint", {
  lineNumber: 10,
  url: "file:///path/to/my/script.js",
});
```

In this example, the `'inspectorNotification'` event is used to listen for breakpoint events. When a breakpoint is hit, the event listener prints a message to the console.

***

### Event: `<inspector-protocol-method>`

Notifications are messages from the inspector that announce an event. This event is emitted when a notification is received that has its `method` field set to the `<inspector-protocol-method>` value.

**Simplified Explanation:**

Imagine the inspector as a tool that can talk to your code and send messages about what's happening. This event is triggered when the inspector sends a specific message, like "The program has paused because of a breakpoint."

**Example:**

```javascript
// Example showing how to catch the `'Debugger.paused'` notification
session.on("Debugger.paused", ({ params }) => {
  console.log(`Program paused at: ${params.hitBreakpoints}`);
});
```

**Real-World Application:**

This event is useful for debugging code. For example, you can use it to print a message whenever a breakpoint is hit, making it easier to track the flow of your program.

**Potential Applications:**

* Debugging code
* Monitoring program execution
* Profiling code to identify performance bottlenecks

***

**Topic 1: Connecting a Session to the Inspector Back-End**

**Simplified Explanation:** Imagine you have a toy car that you want to control remotely. The inspector back-end is like the remote control, and it allows you to send commands to the toy car (in this case, your debugging session).

**Detailed Explanation:** The `session.connect()` method establishes a connection between your debugging session and the inspector back-end, which is responsible for receiving commands and transmitting debugging data.

**Code Snippet:**

```javascript
const session = new inspector.Session();
session.connect();
```

**Real-World Example:** When you run your Node.js application with the `--inspect` flag, the V8 inspector creates a debugging session. You can use the `inspector` module to connect to this session and control the debugging process remotely.

**Potential Applications:**

* Remote debugging of Node.js applications
* Profiling and performance analysis
* Code coverage measurement

**Topic 2: Disconnecting a Session from the Inspector Back-End**

**Simplified Explanation:** Once you're finished debugging, you can disconnect the session from the inspector back-end, so that it stops receiving commands and transmitting data.

**Detailed Explanation:** The `session.disconnect()` method terminates the connection between the debugging session and the inspector back-end.

**Code Snippet:**

```javascript
session.disconnect();
```

**Real-World Example:** When you close the debugging tools (e.g., Chrome DevTools), the connection between the debugging session and the inspector back-end is automatically disconnected.

**Potential Applications:**

* Cleaning up resources after debugging is complete
* Preventing unwanted debugging activity

**Topic 3: Sending Commands to the Inspector Back-End**

**Simplified Explanation:** Once you have a connection established, you can send commands to the inspector back-end to control the debugging process.

**Detailed Explanation:** The `session.post()` method allows you to send commands to the inspector back-end. The commands are typically JSON-formatted messages.

**Code Snippet:**

```javascript
session.post("Debugger.resume");
```

**Real-World Example:** You can use commands to:

* Pause or resume execution
* Set breakpoints
* Inspect variables
* Profile code performance

**Potential Applications:**

* Advanced debugging scenarios
* Automating debugging tasks

***

**Connecting a Session to the Main Thread Inspector Back-End**

Imagine you have two separate computers connected by a cable. One computer represents the main thread, which is like the boss, and the other represents a worker thread, which is like an employee.

The inspector module provides a way to connect the worker thread to the main thread so that the boss can inspect what the employee is doing. This is like giving the boss access to the employee's computer so they can see what they're working on.

**How to Connect:**

To connect the worker thread to the main thread, you use the `session.connectToMainThread()` function. This function will create a connection between the two computers (main thread and worker thread).

**Important:** You must call this function on the worker thread, not the main thread. It's like the boss should be the one connecting to the employee, not the other way around.

**Example:**

```javascript
// On the worker thread
const { session } = require("inspector");

// Connect to the main thread inspector back-end
session.connectToMainThread();

// Now the boss (main thread) can inspect what the worker thread is doing.
```

**Applications:**

This feature is useful for debugging and performance analysis. It allows developers to monitor the activity of worker threads and identify any potential issues. For example:

* A web developer can use the inspector to analyze the performance of a complex web application that uses worker threads for background tasks.
* A game developer can use the inspector to debug a multiplayer game where each player is running their own worker thread.

***

### `session.disconnect()`

#### Explanation:

The `session.disconnect()` method is used to immediately close the debugging session. When you call this method, all messages that were waiting to be sent will be called with an error. To start sending messages again, you need to call the `session.connect()` method.

It's important to note that when you reconnect the session, you will lose all of the inspector state, including enabled agents and configured breakpoints.

#### Real-World Example:

```javascript
const { InspectorSession } = require("inspector");

const session = new InspectorSession();

// Connect to the inspector session
session.connect();

// Send a message (e.g., to evaluate an expression)
session.post("Runtime.evaluate", { expression: "1 + 1" }, (err, response) => {
  if (err) {
    console.error("Error evaluating expression:", err);
    return;
  }

  console.log("Eval result:", response.result.value);

  // Disconnect the session
  session.disconnect();
});
```

#### Potential Applications:

* Debugging in production environments
* Remote debugging of a running application
* Integration with other debugging tools

***

### `session.post(method[, params][, callback])`

**Purpose:**

This method allows you to send messages to the inspector back-end, a tool that helps with debugging and inspecting your web application. When you send a message, the inspector back-end processes it and sends a response back to your program.

**Parameters:**

| Parameter  | Description                                                                                         |
| ---------- | --------------------------------------------------------------------------------------------------- |
| `method`   | The name of the method you want to call on the inspector back-end. For example, `Runtime.evaluate`. |
| `params`   | (Optional) An object containing the parameters for the method call.                                 |
| `callback` | (Optional) A function that will be called when a response is received from the inspector back-end.  |

**Response:**

The `callback` function will be called with two arguments:

| Argument | Description                                                       |
| -------- | ----------------------------------------------------------------- |
| `error`  | `null` if the request was successful, otherwise an error message. |
| `result` | An object containing the result of the method call.               |

**Simplified Example:**

```js
session.post("Runtime.evaluate", { expression: "2 + 2" }, (error, response) => {
  console.log(response.result.value); // Output: 4
});
```

In this example, we are sending a message to the inspector back-end asking it to evaluate the expression `2 + 2`. The response from the inspector back-end contains the result of the evaluation, which is `4`.

**Real-World Applications:**

This method can be used for a variety of purposes, including:

* Debugging your application by inspecting the state of the JavaScript engine.
* Testing your application by sending mock user input to the inspector.
* Profiling your application to identify performance bottlenecks.
* Extending the inspector with custom features.

**Potential Applications:**

* **Debugging:** You can use this method to inspect the state of your application at any point in time. This can help you find bugs and understand why your application is behaving in a certain way.
* **Testing:** You can use this method to send mock user input to your application. This can help you test your application's behavior under different conditions.
* **Profiling:** You can use this method to profile your application and identify performance bottlenecks. This can help you optimize your application's performance.
* **Extending the inspector:** You can use this method to extend the inspector with custom features. This can help you create a more tailored debugging and inspection experience.

***

**Simplified Explanation:**

Imagine V8 as the engine that powers your web browser (e.g., Chrome). It's like the machine that runs the code in your browser.

Apart from the debugger, V8 has special tools called "profilers" that help you understand how your code is running and if it's running efficiently.

These profilers are accessible through a special communication protocol called "DevTools protocol." It's like a secret handshake that allows you to interact with V8 from outside your browser.

**Real-World Applications:**

Profilers are essential for:

* **Performance Analysis:** Identifying bottlenecks in your code to make it run faster.
* **Memory Optimization:** Detecting memory leaks to prevent your browser from crashing.
* **Code Profiling:** Understanding how your code uses CPU and memory resources.

**Complete Code Implementation:**

To use V8 profilers, you need to use the "inspector" module in Node.js.

```js
const { inspector } = require("inspector");

// Start a session to connect to DevTools
inspector.connect();

// Get the profiling API
const profiling = inspector.Profiler;

// Start a CPU profile
profiling.start();

// Run your code
// ...

// Stop the CPU profile
profiling.stop();

// Retrieve the profile data
const profileData = profiling.getProfile();
```

**Potential Applications:**

* **Optimizing a web app's performance:** Identifying slow parts of the code and making them faster.
* **Troubleshooting memory issues:** Detecting and fixing memory leaks that can cause crashes.
* **Understanding code performance:** Analyzing how code uses CPU and memory resources to improve its efficiency.

***

### CPU Profiler

#### What is a CPU Profiler?

A CPU profiler is a tool that helps you measure your program's performance and find out which parts of your code are using the most CPU time. This can be useful for optimizing your code and making it run faster.

#### How to use the CPU Profiler

To use the CPU profiler, you first need to start a session with the inspector. You can do this by running the following command:

```Bash
node --inspect
```

This will start a session and open a new window in your browser.

Once you have started a session, you can connect to it using the following code:

```js
const inspector = require("node:inspector");
const session = new inspector.Session();
session.connect();
```

Once you are connected to the session, you can start profiling your application by running the following command:

```js
session.post("Profiler.start", () => {
  // Invoke business logic under measurement here...

  // some time later...
  session.post("Profiler.stop", (err, { profile }) => {
    // Write profile to disk, upload, etc.
    if (!err) {
      fs.writeFileSync("./profile.cpuprofile", JSON.stringify(profile));
    }
  });
});
```

The `Profiler.start` command starts the profiler, and the `Profiler.stop` command stops it. The profile object that is returned by the `Profiler.stop` command contains a lot of information about your application's performance, including:

* The amount of time spent in each function
* The number of times each function was called
* The amount of memory used by each function
* The amount of time spent in garbage collection

You can use this information to identify the parts of your application that are using the most CPU time and focus your optimization efforts on those areas.

#### Real World Applications

CPU profiling can be used in a variety of real-world applications, such as:

* **Identifying performance bottlenecks:** CPU profiling can help you identify the parts of your application that are using the most CPU time and causing performance bottlenecks.
* **Optimizing your code:** CPU profiling can help you optimize your code by identifying the parts of your code that are using the most CPU time and making changes to reduce the amount of time they spend in those areas.
* **Debugging memory leaks:** CPU profiling can help you debug memory leaks by identifying the parts of your code that are using the most memory and causing the memory leak.

#### Improved Example

Here is an improved example of how to use the CPU profiler:

```js
const inspector = require("node:inspector");
const fs = require("node:fs");
const session = new inspector.Session();
session.connect();

session.post("Profiler.enable", () => {
  session.post("Profiler.start", () => {
    // Invoke business logic under measurement here...

    // some time later...
    session.post("Profiler.stop", (err, { profile }) => {
      if (!err) {
        fs.writeFileSync("./profile.cpuprofile", JSON.stringify(profile));
        console.log("CPU profile saved to ./profile.cpuprofile");
      } else {
        console.error("Error saving CPU profile:", err);
      }
    });
  });
});
```

This example includes some error handling and prints a message to the console when the profile has been saved.

***

### Heap Profiler - A Tool to Analyze Memory Usage

The Heap Profiler is a tool that helps you understand how your Node.js application uses memory. It can be used to identify memory leaks, optimize memory usage, and improve the performance of your application.

#### How it Works

The Heap Profiler takes a snapshot of the memory used by your application at a specific point in time. This snapshot includes information about all the objects that are currently allocated in memory, as well as their size and type.

You can then use the Heap Profiler to analyze the snapshot and identify any potential problems. For example, you can look for objects that are no longer being used, but are still taking up memory. You can also look for objects that are taking up more memory than they need to.

#### How to Use the Heap Profiler

To use the Heap Profiler, you need to first connect to your application using the `inspector` module. Once you are connected, you can use the `HeapProfiler` class to take a snapshot of the memory used by your application.

The following code shows how to use the Heap Profiler to take a snapshot of the memory used by your application and save it to a file:

```javascript
const inspector = require("node:inspector");
const fs = require("node:fs");

const session = new inspector.Session();

const fd = fs.openSync("profile.heapsnapshot", "w");

session.connect();

session.on("HeapProfiler.addHeapSnapshotChunk", (m) => {
  fs.writeSync(fd, m.params.chunk);
});

session.post("HeapProfiler.takeHeapSnapshot", null, (err, r) => {
  console.log("HeapProfiler.takeHeapSnapshot done:", err, r);
  session.disconnect();
  fs.closeSync(fd);
});
```

#### Real-World Applications

The Heap Profiler can be used in a variety of real-world applications, including:

* **Identifying memory leaks:** The Heap Profiler can help you identify objects that are no longer being used, but are still taking up memory. This can help you to prevent memory leaks and improve the performance of your application.
* **Optimizing memory usage:** The Heap Profiler can help you understand how your application uses memory. This information can help you to optimize memory usage and reduce the amount of memory that your application needs to run.
* **Improving application performance:** The Heap Profiler can help you identify objects that are taking up more memory than they need to. This information can help you to improve the performance of your application by reducing the amount of memory that it uses.

#### Conclusion

The Heap Profiler is a powerful tool that can help you to understand how your Node.js application uses memory. It can be used to identify memory leaks, optimize memory usage, and improve the performance of your application.

***

**Inspector Module**

**Overview:**

The inspector module allows you to debug and inspect Node.js applications remotely while they are running. It provides a range of features for debugging and profiling your code, including:

* Setting breakpoints
* Inspecting variables
* Profiling code performance

**Usage:**

To use the inspector module, you need to start your Node.js application with the `--inspect` flag. For example:

```
node --inspect index.js
```

This will start your application in inspect mode and open a new window in your browser that shows the inspector interface.

**Features:**

**Breakpoints:**

Breakpoints allow you to pause your application at a specific line of code and inspect the state of your variables. To set a breakpoint, click on the line number in the left sidebar of the inspector interface.

**Variable Inspection:**

You can inspect the values of variables in your running application. To do this, hover over a variable in the code editor, or click on it in the "Scope" panel. The value of the variable will be displayed in a tooltip.

**Profiling:**

The inspector module includes a profiler that can help you identify performance bottlenecks in your code. To start profiling, click on the "Profiles" tab in the inspector interface. The profiler will record the performance of your code and generate a report that you can use to optimize your application.

**Real-World Applications:**

The inspector module has a wide range of applications in real-world development, including:

* **Debugging:** Quickly identify and fix errors in your code.
* **Profiling:** Improve the performance of your application by identifying and resolving performance bottlenecks.
* **Testing:** Use the inspector to test the behavior of your code and verify that it meets expectations.
* **Education:** Learn about the inner workings of Node.js and how to write more efficient and reliable code.

***

#### Simplified Explanation of `inspector.close()`

**What is Inspector?**

Inspector is a tool in Node.js that allows you to inspect and debug your code while it's running. It lets you examine variables, set breakpoints, and generally get a better understanding of what's happening inside your program.

**What does `inspector.close()` do?**

When you're done using the Inspector, you can call `inspector.close()` to shut it down and free up resources. This function:

* Attempts to close all connections to the Inspector.
* Blocks the event loop until all connections are closed.
* Deactivates the Inspector, preventing further connections.

**Why would you want to close the Inspector?**

You might want to close the Inspector for a few reasons:

* **Security:** The Inspector opens a connection to your program, which could potentially be exploited by an attacker. Closing the Inspector reduces the risk of such an attack.
* **Performance:** The Inspector can slow down your program, especially if you're using it to debug a large or complex application. Closing the Inspector can improve performance.
* **Resource cleanup:** The Inspector uses system resources, such as memory and CPU. Closing the Inspector frees up these resources for other tasks.

**How to use `inspector.close()`**

To close the Inspector, simply call `inspector.close()`. It's a synchronous function, so it will block the event loop until all connections are closed.

```javascript
const inspector = require("inspector");

// Close the Inspector
inspector.close();

// The Inspector is now closed and all connections are freed
```

**Real-world applications**

Here are a few real-world applications of `inspector.close()`:

* **Debugging:** After you've finished debugging your program, you can close the Inspector to improve performance and security.
* **Profiling:** If you're using the Inspector to profile your program, you can close it once you've collected the data you need.
* **Deployment:** When you're deploying your program to a production environment, you can close the Inspector to improve security and performance.

***

#### `inspector.console`

* **{Object} An object to send messages to the remote inspector console.**

```js
const inspector = require("node:inspector");

// Send a message to the remote inspector console.
inspector.console.log("Hello, world!");
```

The inspector console is a tool that allows you to debug your Node.js applications remotely. It provides a number of features, including the ability to:

* View the output of your application's console.log() statements.
* Evaluate JavaScript expressions in the context of your application.
* Set breakpoints in your code.
* Profile your application's performance.

The inspector console is a valuable tool for debugging and optimizing your Node.js applications. It is especially useful for debugging issues that occur on remote servers or in production environments.

#### Real-world example

The following code shows how to use the inspector console to debug a Node.js application that is running on a remote server:

```js
const inspector = require("node:inspector");

// Start the inspector agent and listen for incoming connections on port 9229.
inspector.startInspector({ host: "localhost", port: 9229 });

// Open the inspector console in your browser by navigating to http://localhost:9229.
```

Once you have connected to the inspector console, you can use it to view the output of your application's console.log() statements, evaluate JavaScript expressions, and set breakpoints.

#### Potential applications

The inspector console has a number of potential applications in the real world, including:

* **Debugging**: The inspector console can be used to debug issues that occur on remote servers or in production environments.
* **Profiling**: The inspector console can be used to profile your application's performance and identify bottlenecks.
* **Testing**: The inspector console can be used to test your application's functionality and ensure that it is working as expected.

***

#### Simplified Explanation of `inspector.open()`

**What is it?**

`inspector.open()` is a function in Node.js that allows you to activate the built-in JavaScript inspector tool. This tool lets you inspect and debug your code while it's running.

**How to Use It**

You call `inspector.open()` with three optional parameters:

* `port`: The port the inspector should listen on for connections.
* `host`: The host or IP address the inspector should listen on.
* `wait`: If `true`, the function will block until a client has connected to the inspector.

**Example**

```javascript
const inspector = require("inspector");

// Start the inspector on port 9229
inspector.open(9229);
```

#### Real-World Complete Code Implementation

```javascript
const inspector = require("inspector");

// Start the inspector on port 9229 and block until a client connects
inspector.open(9229, true);

// You can now debug your code using a tool like Chrome DevTools
```

#### Potential Applications

* Debugging code while it's running
* Profiling code to identify performance bottlenecks
* Setting breakpoints and inspecting variables
* Remotely debugging code from anywhere

***

**Summary:**

The `inspector.url()` method in Node.js returns the URL of the active inspector, or `undefined` if there is none.

**Details:**

* **What is Inspector?**
  * Inspector is a tool in Node.js that allows you to debug and profile your code remotely. It provides a user interface that displays information about your code's execution, memory usage, and more.
* **How to use Inspector?**
  * You can start Inspector by passing the `--inspect` flag when running your Node.js program. This flag opens an Inspector session on a specific port (9229 by default).
* **Inspector URL**
  * The `inspector.url()` method returns the URL where you can access the Inspector user interface. This URL typically looks like `ws://localhost:PORT/SESSION_ID`, where `PORT` is the port number (default: 9229) and `SESSION_ID` is a unique identifier for the Inspector session.
* **Example:**
  * Start Inspector using the `--inspect` flag:

    ```
    node --inspect my-script.js
    ```
  * Get the Inspector URL using `inspector.url()`:

    ```
     inspector.url(); // Returns "ws://localhost:9229/SESSION_ID"
    ```
  * Open the Inspector user interface by visiting the URL in a web browser.

**Real-World Applications:**

* **Debugging Code:** You can use Inspector to pause your code execution, inspect variables, and step through the code line by line. This helps you quickly identify and fix bugs.
* **Profiling Performance:** Inspector provides tools to analyze your code's performance and identify bottlenecks. This can help you optimize your code for speed and memory usage.
* **Remote Debugging:** Inspector allows you to debug your code remotely, which is useful when your code is running on a server or in a cloud environment.

***

**Explain the content in detail and simplified manner**

`inspector.waitForDebugger()` is a function in the `inspector` module of Node.js. It allows a Node.js program to pause execution and wait for a debugger client to connect.

**Simplified explanation**

Imagine you're writing a Node.js program and you want to pause it at a certain point to debug it. You can use the `inspector.waitForDebugger()` function to do that. It will pause your program until a debugger client connects to it.

**Code snippet**

```javascript
const inspector = require("inspector");

inspector.waitForDebugger();

// Your code goes here...
```

**Real-world example**

You could use `inspector.waitForDebugger()` in a development environment to pause your program at a specific breakpoint and inspect the state of the program. This can be helpful for debugging errors or understanding the flow of your program.

**Potential applications in the real world**

* Debugging: Pausing your program to inspect its state can help you find and fix bugs.
* Performance profiling: You can use `inspector.waitForDebugger()` to pause your program and collect performance data. This can help you identify performance bottlenecks and optimize your code.
* Code coverage: You can use `inspector.waitForDebugger()` to pause your program and collect code coverage data. This can help you identify which parts of your code are not being executed.

***

### Support for Breakpoints in Node.js

#### Introduction

The Inspector module in Node.js allows you to debug your JavaScript code using the Chrome DevTools Protocol. One of the key features of debugging is the ability to set breakpoints, which pause the execution of your code at specific points so you can examine the state of your program.

#### Setting Breakpoints with a Same-Thread Session

**Avoid:**

Setting breakpoints with a same-thread session, meaning the debugging session is attached to the same thread as the code being debugged, is not recommended. This can lead to the debugger itself pausing.

#### Setting Breakpoints with a Main Thread Session

**Preferred:**

To set breakpoints safely, you should connect to the main thread of your application and set breakpoints in a worker thread. Here's how you can do that:

```javascript
const inspector = require("inspector");
const session = new inspector.Session();

// Connect to the main thread
session.connectToMainThread();

// Set a breakpoint in a worker thread with ID 1
session.sendCommand("Debugger.setBreakpointByUrl", {
  url: "path/to/worker-script.js",
  lineNumber: 10,
  columnNumber: 0,
});
```

#### Setting Breakpoints with a Remote Debugger

**Alternative:**

You can also use a standalone Debugger program to connect to your application remotely over a WebSocket connection. This allows you to set breakpoints from a separate machine.

#### Real-World Applications

Breakpoints are essential for debugging complex codebases. They allow developers to:

* Pause the execution at specific points to inspect the state of variables
* Step through the code line-by-line to track the flow of execution
* Identify bugs and errors more easily


---

# Agent Instructions: Querying This Documentation

If you need additional information that is not directly available in this page, you can query the documentation dynamically by asking a question.

Perform an HTTP GET request on the current page URL with the `ask` query parameter:

```
GET https://a7246c5516ab4c80cdfe21ca2be3e40c.gitbook.io/nodejs-docs/inspector.md?ask=<question>
```

The question should be specific, self-contained, and written in natural language.
The response will contain a direct answer to the question and relevant excerpts and sources from the documentation.

Use this mechanism when the answer is not explicitly present in the current page, you need clarification or additional context, or you want to retrieve related documentation sections.
